C18H16N2O4 — CID 101168607
[(1S,2R)-2-nitro-2-[(1R,2S)-1-nitro-2-phenylcyclopropyl]cyclopropyl]benzene (PubChem CID 101168607) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is [(1S,2R)-2-nitro-2-[(1R,2S)-1-nitro-2-phenylcyclopropyl]cyclopropyl]benzene.
| Compound Name | [(1S,2R)-2-nitro-2-[(1R,2S)-1-nitro-2-phenylcyclopropyl]cyclopropyl]benzene |
|---|---|
| PubChem CID | 101168607 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [(1S,2R)-2-nitro-2-[(1R,2S)-1-nitro-2-phenylcyclopropyl]cyclopropyl]benzene |
| SMILES | O=[N+]([O-])[C@]1([C@@]2([N+](=O)[O-])C[C@H]2c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c21-19(22)17(11-15(17)13-7-3-1-4-8-13)18(20(23)24)12-16(18)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16-,17+,18+/m0/s1 |
| InChIKey | BCKKWBOTFYTIDD-WNRNVDISSA-N |
| XLogP | 3.39 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|