C14H17NO3 — CID 101223769
2,2-dimethyl-1-[(1S,2S)-1-nitro-2-phenylcyclopropyl]propan-1-one (PubChem CID 101223769) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(1S,2S)-1-nitro-2-phenylcyclopropyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[(1S,2S)-1-nitro-2-phenylcyclopropyl]propan-1-one |
|---|---|
| PubChem CID | 101223769 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2,2-dimethyl-1-[(1S,2S)-1-nitro-2-phenylcyclopropyl]propan-1-one |
| SMILES | CC(C)(C)C(=O)[C@]1([N+](=O)[O-])C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO3/c1-13(2,3)12(16)14(15(17)18)9-11(14)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | BRDMORMUSOGDBS-FZMZJTMJSA-N |
| XLogP | 2.80 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|