C12H12ClNO4 — CID 134860664
trans-ethyl (1R,2S)-2-(3-chlorophenyl)-1-nitrocyclopropane-1-carboxylate (PubChem CID 134860664) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-(3-chlorophenyl)-1-nitrocyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-(3-chlorophenyl)-1-nitrocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134860664 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | trans-ethyl (1R,2S)-2-(3-chlorophenyl)-1-nitrocyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1([N+](=O)[O-])C[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H12ClNO4/c1-2-18-11(15)12(14(16)17)7-10(12)8-4-3-5-9(13)6-8/h3-6,10H,2,7H2,1H3/t10-,12+/m0/s1 |
| InChIKey | NFBVHTWVMOJEOC-CMPLNLGQSA-N |
| XLogP | 2.41 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|