About cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate
cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate (PubChem CID 102578477) has the molecular formula C9H14N2O5
and a molecular weight of 230.22 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate |
| PubChem CID | 102578477 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1([N+](=O)[O-])C[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C9H14N2O5/c1-4-16-8(13)9(11(14)15)5-6(9)7(12)10(2)3/h6H,4-5H2,1-3H3/t6-,9-/m0/s1 |
| InChIKey | WYMKEFCYAYRECY-RCOVLWMOSA-N |
| XLogP | -0.33 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate (CID 102578477) is cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate is CCOC(=O)[C@]1([N+](=O)[O-])C[C@H]1C(=O)N(C)C.
What is the InChIKey of cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate?
The InChIKey is WYMKEFCYAYRECY-RCOVLWMOSA-N. The full InChI is InChI=1S/C9H14N2O5/c1-4-16-8(13)9(11(14)15)5-6(9)7(12)10(2)3/h6H,4-5H2,1-3H3/t6-,9-/m0/s1.
What are the key properties of cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate?
cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate has a molecular weight of 230.22 g/mol, XLogP of -0.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2R)-2-(dimethylcarbamoyl)-1-nitrocyclopropane-1-carboxylate is sourced from PubChem (CID 102578477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).