C15H19NO4 — CID 101386434
trans-methyl (1R,2S)-2-(4-tert-butylphenyl)-1-nitrocyclopropane-1-carboxylate (PubChem CID 101386434) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is trans-methyl (1R,2S)-2-(4-tert-butylphenyl)-1-nitrocyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-2-(4-tert-butylphenyl)-1-nitrocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101386434 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | trans-methyl (1R,2S)-2-(4-tert-butylphenyl)-1-nitrocyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1([N+](=O)[O-])C[C@H]1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H19NO4/c1-14(2,3)11-7-5-10(6-8-11)12-9-15(12,16(18)19)13(17)20-4/h5-8,12H,9H2,1-4H3/t12-,15+/m0/s1 |
| InChIKey | ZKMAZSVQFGLBNA-SWLSCSKDSA-N |
| XLogP | 2.66 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|