C11H11NO7 — CID 135000813
methyl (5S)-3-hydroxy-5-(4-nitrophenyl)dioxolane-3-carboxylate (PubChem CID 135000813) has the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. Its IUPAC name is methyl (5S)-3-hydroxy-5-(4-nitrophenyl)dioxolane-3-carboxylate.
| Compound Name | methyl (5S)-3-hydroxy-5-(4-nitrophenyl)dioxolane-3-carboxylate |
|---|---|
| PubChem CID | 135000813 |
| Molecular Formula | C11H11NO7 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl (5S)-3-hydroxy-5-(4-nitrophenyl)dioxolane-3-carboxylate |
| SMILES | COC(=O)C1(O)C[C@@H](c2ccc([N+](=O)[O-])cc2)OO1 |
| InChI | InChI=1S/C11H11NO7/c1-17-10(13)11(14)6-9(18-19-11)7-2-4-8(5-3-7)12(15)16/h2-5,9,14H,6H2,1H3/t9-,11?/m0/s1 |
| InChIKey | XLTATFYHUOADQR-FTNKSUMCSA-N |
| XLogP | 0.85 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|