C26H30N2O6 — CID 174540404
dimethyl 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-propyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 174540404) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-propyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-propyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 174540404 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-propyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCC1(C)NC(C)=C(C(=O)OC)C(c2cccc([N+](=O)[O-])c2)C1(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O6/c1-6-15-25(3)26(24(30)34-5,19-12-8-7-9-13-19)22(21(17(2)27-25)23(29)33-4)18-11-10-14-20(16-18)28(31)32/h7-14,16,22,27H,6,15H2,1-5H3 |
| InChIKey | JQGIXRMOBUEZAT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|