C24H24N2O6 — CID 70092479
2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-[(E)-prop-1-enyl]-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70092479) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-[(E)-prop-1-enyl]-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-[(E)-prop-1-enyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70092479 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2,6-dimethyl-4-(3-nitrophenyl)-3-phenyl-2-[(E)-prop-1-enyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | C/C=C/C1(C)NC(C)=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O6/c1-4-13-23(3)24(22(29)30,17-10-6-5-7-11-17)20(19(21(27)28)15(2)25-23)16-9-8-12-18(14-16)26(31)32/h4-14,20,25H,1-3H3,(H,27,28)(H,29,30)/b13-4+ |
| InChIKey | PXTOZBUBNAQREM-YIXHJXPBSA-N |
| XLogP | 4.00 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|