C18H23N2O4P — CID 70042847
5-diethylphosphanyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70042847) has the molecular formula C18H23N2O4P and a molecular weight of 362.37 g/mol. Its IUPAC name is 5-diethylphosphanyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-diethylphosphanyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70042847 |
| Molecular Formula | C18H23N2O4P |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 5-diethylphosphanyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CCP(CC)C1=C(C)NC(C)=C(C(=O)O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N2O4P/c1-5-25(6-2)17-12(4)19-11(3)15(18(21)22)16(17)13-8-7-9-14(10-13)20(23)24/h7-10,16,19H,5-6H2,1-4H3,(H,21,22) |
| InChIKey | LNCSFQMVSDSSHH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|