C16H21NO4 — CID 14062338
dimethyl 2,3-dimethyl-5-phenylpyrrolidine-2,4-dicarboxylate (PubChem CID 14062338) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is dimethyl 2,3-dimethyl-5-phenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl 2,3-dimethyl-5-phenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 14062338 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | dimethyl 2,3-dimethyl-5-phenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)NC(C)(C(=O)OC)C1C |
| InChI | InChI=1S/C16H21NO4/c1-10-12(14(18)20-3)13(11-8-6-5-7-9-11)17-16(10,2)15(19)21-4/h5-10,12-13,17H,1-4H3 |
| InChIKey | VGCDTWPHOLNORH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |