C19H25NO6 — CID 10642456
3-O,4-O-dimethyl 2-O-propan-2-yl (2R,3R,4R,5S)-2-methyl-5-phenylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 10642456) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-O,4-O-dimethyl 2-O-propan-2-yl (2R,3R,4R,5S)-2-methyl-5-phenylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-dimethyl 2-O-propan-2-yl (2R,3R,4R,5S)-2-methyl-5-phenylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 10642456 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-O,4-O-dimethyl 2-O-propan-2-yl (2R,3R,4R,5S)-2-methyl-5-phenylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccccc2)N[C@@](C)(C(=O)OC(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H25NO6/c1-11(2)26-18(23)19(3)14(17(22)25-5)13(16(21)24-4)15(20-19)12-9-7-6-8-10-12/h6-11,13-15,20H,1-5H3/t13-,14+,15-,19-/m1/s1 |
| InChIKey | PHORJEYHCRTNCV-NXEZDXNNSA-N |
| XLogP | 1.62 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|