C24H27NO6 — CID 101412379
4-O-[(2S)-1-methoxy-1-oxopropan-2-yl] 2-O-methyl (2S,4R,5S)-2-benzyl-5-phenylpyrrolidine-2,4-dicarboxylate (PubChem CID 101412379) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 4-O-[(2S)-1-methoxy-1-oxopropan-2-yl] 2-O-methyl (2S,4R,5S)-2-benzyl-5-phenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | 4-O-[(2S)-1-methoxy-1-oxopropan-2-yl] 2-O-methyl (2S,4R,5S)-2-benzyl-5-phenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 101412379 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-O-[(2S)-1-methoxy-1-oxopropan-2-yl] 2-O-methyl (2S,4R,5S)-2-benzyl-5-phenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H](C)OC(=O)[C@@H]1C[C@](Cc2ccccc2)(C(=O)OC)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H27NO6/c1-16(21(26)29-2)31-22(27)19-15-24(23(28)30-3,14-17-10-6-4-7-11-17)25-20(19)18-12-8-5-9-13-18/h4-13,16,19-20,25H,14-15H2,1-3H3/t16-,19+,20+,24+/m0/s1 |
| InChIKey | HQILZJMBPPFUSK-FROCWPDGSA-N |
| XLogP | 2.60 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|