C19H26N2O5 — CID 138627975
methyl (3R)-3-acetyloxy-2-[(2-benzylpyrrolidine-2-carbonyl)amino]butanoate (PubChem CID 138627975) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl (3R)-3-acetyloxy-2-[(2-benzylpyrrolidine-2-carbonyl)amino]butanoate.
| Compound Name | methyl (3R)-3-acetyloxy-2-[(2-benzylpyrrolidine-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 138627975 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl (3R)-3-acetyloxy-2-[(2-benzylpyrrolidine-2-carbonyl)amino]butanoate |
| SMILES | COC(=O)C(NC(=O)C1(Cc2ccccc2)CCCN1)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C19H26N2O5/c1-13(26-14(2)22)16(17(23)25-3)21-18(24)19(10-7-11-20-19)12-15-8-5-4-6-9-15/h4-6,8-9,13,16,20H,7,10-12H2,1-3H3,(H,21,24)/t13-,16?,19?/m1/s1 |
| InChIKey | ZNDJMEQTUZSRNF-DAIYRKSASA-N |
| XLogP | 0.96 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |