C28H34N2O7 — CID 135309217
benzyl 2-[(3-acetyloxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]-2-[(3-methylphenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 135309217) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is benzyl 2-[(3-acetyloxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]-2-[(3-methylphenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(3-acetyloxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]-2-[(3-methylphenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135309217 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | benzyl 2-[(3-acetyloxy-1-methoxy-1-oxobutan-2-yl)carbamoyl]-2-[(3-methylphenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)C(NC(=O)C1(Cc2cccc(C)c2)CCCN1C(=O)OCc1ccccc1)C(C)OC(C)=O |
| InChI | InChI=1S/C28H34N2O7/c1-19-10-8-13-23(16-19)17-28(26(33)29-24(25(32)35-4)20(2)37-21(3)31)14-9-15-30(28)27(34)36-18-22-11-6-5-7-12-22/h5-8,10-13,16,20,24H,9,14-15,17-18H2,1-4H3,(H,29,33) |
| InChIKey | MYSXLUYABLUNAL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|