C26H36NO5P — CID 139254813
tert-butyl (2S,3S,5R)-5-benzyl-5-diethoxyphosphoryl-2-phenylpyrrolidine-3-carboxylate (PubChem CID 139254813) has the molecular formula C26H36NO5P and a molecular weight of 473.55 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R)-5-benzyl-5-diethoxyphosphoryl-2-phenylpyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (2S,3S,5R)-5-benzyl-5-diethoxyphosphoryl-2-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139254813 |
| Molecular Formula | C26H36NO5P |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | tert-butyl (2S,3S,5R)-5-benzyl-5-diethoxyphosphoryl-2-phenylpyrrolidine-3-carboxylate |
| SMILES | CCOP(=O)(OCC)[C@@]1(Cc2ccccc2)C[C@H](C(=O)OC(C)(C)C)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C26H36NO5P/c1-6-30-33(29,31-7-2)26(18-20-14-10-8-11-15-20)19-22(24(28)32-25(3,4)5)23(27-26)21-16-12-9-13-17-21/h8-17,22-23,27H,6-7,18-19H2,1-5H3/t22-,23+,26-/m0/s1 |
| InChIKey | JZJWBEZIODHQNG-ZEVJAHDQSA-N |
| XLogP | 5.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|