C20H27NO4 — CID 132597008
3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-phenyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate (PubChem CID 132597008) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-phenyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate.
| Compound Name | 3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-phenyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate |
|---|---|
| PubChem CID | 132597008 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-phenyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate |
| SMILES | COC(=O)[C@]12CCC[C@H]1[C@H](C(=O)OC(C)(C)C)[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H27NO4/c1-19(2,3)25-17(22)15-14-11-8-12-20(14,18(23)24-4)21-16(15)13-9-6-5-7-10-13/h5-7,9-10,14-16,21H,8,11-12H2,1-4H3/t14-,15-,16+,20-/m0/s1 |
| InChIKey | CQEAZFMSEWZKDH-MFCZKXCZSA-N |
| XLogP | 3.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |