C14H17NO2S — CID 134925362
methyl (2R,3aS,6aS)-2-phenyl-1,2,3,3a,4,6-hexahydrothieno[3,4-b]pyrrole-6a-carboxylate (PubChem CID 134925362) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl (2R,3aS,6aS)-2-phenyl-1,2,3,3a,4,6-hexahydrothieno[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | methyl (2R,3aS,6aS)-2-phenyl-1,2,3,3a,4,6-hexahydrothieno[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 134925362 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl (2R,3aS,6aS)-2-phenyl-1,2,3,3a,4,6-hexahydrothieno[3,4-b]pyrrole-6a-carboxylate |
| SMILES | COC(=O)[C@]12CSC[C@H]1C[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C14H17NO2S/c1-17-13(16)14-9-18-8-11(14)7-12(15-14)10-5-3-2-4-6-10/h2-6,11-12,15H,7-9H2,1H3/t11-,12-,14+/m1/s1 |
| InChIKey | ZAAZPZPYTLDTQX-BZPMIXESSA-N |
| XLogP | 2.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |