C21H29NO4 — CID 134959729
3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-(2-methylphenyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate (PubChem CID 134959729) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-(2-methylphenyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate.
| Compound Name | 3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-(2-methylphenyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate |
|---|---|
| PubChem CID | 134959729 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-O-tert-butyl 6a-O-methyl (2S,3S,3aS,6aS)-2-(2-methylphenyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrole-3,6a-dicarboxylate |
| SMILES | COC(=O)[C@]12CCC[C@H]1[C@H](C(=O)OC(C)(C)C)[C@@H](c1ccccc1C)N2 |
| InChI | InChI=1S/C21H29NO4/c1-13-9-6-7-10-14(13)17-16(18(23)26-20(2,3)4)15-11-8-12-21(15,22-17)19(24)25-5/h6-7,9-10,15-17,22H,8,11-12H2,1-5H3/t15-,16-,17+,21-/m0/s1 |
| InChIKey | IQNSJXGNOWULIY-OPOADAIRSA-N |
| XLogP | 3.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |