C19H25NO5 — CID 12996378
5-O-tert-butyl 3-O-methyl (3S,4R,5S,6R)-4-methyl-2-oxo-6-phenylpiperidine-3,5-dicarboxylate (PubChem CID 12996378) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-methyl (3S,4R,5S,6R)-4-methyl-2-oxo-6-phenylpiperidine-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-methyl (3S,4R,5S,6R)-4-methyl-2-oxo-6-phenylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 12996378 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-O-tert-butyl 3-O-methyl (3S,4R,5S,6R)-4-methyl-2-oxo-6-phenylpiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)N[C@@H](c2ccccc2)[C@@H](C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C19H25NO5/c1-11-13(18(23)25-19(2,3)4)15(12-9-7-6-8-10-12)20-16(21)14(11)17(22)24-5/h6-11,13-15H,1-5H3,(H,20,21)/t11-,13+,14+,15+/m1/s1 |
| InChIKey | JPJZVHDYJBOPCE-UNQGMJICSA-N |
| XLogP | 2.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|