C15H21NO2 — CID 15837692
tert-butyl (2S)-5-phenylpyrrolidine-2-carboxylate (PubChem CID 15837692) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is tert-butyl (2S)-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15837692 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | tert-butyl (2S)-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC(c2ccccc2)N1 |
| InChI | InChI=1S/C15H21NO2/c1-15(2,3)18-14(17)13-10-9-12(16-13)11-7-5-4-6-8-11/h4-8,12-13,16H,9-10H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | QMAKALIREQLSSP-ABLWVSNPSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |