C19H27NO2 — CID 90886408
tert-butyl 7-benzyl-5-methyl-2,3,4,7-tetrahydro-1H-azepine-2-carboxylate (PubChem CID 90886408) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is tert-butyl 7-benzyl-5-methyl-2,3,4,7-tetrahydro-1H-azepine-2-carboxylate.
| Compound Name | tert-butyl 7-benzyl-5-methyl-2,3,4,7-tetrahydro-1H-azepine-2-carboxylate |
|---|---|
| PubChem CID | 90886408 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | tert-butyl 7-benzyl-5-methyl-2,3,4,7-tetrahydro-1H-azepine-2-carboxylate |
| SMILES | CC1=CC(Cc2ccccc2)NC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27NO2/c1-14-10-11-17(18(21)22-19(2,3)4)20-16(12-14)13-15-8-6-5-7-9-15/h5-9,12,16-17,20H,10-11,13H2,1-4H3 |
| InChIKey | MDWPZYORSQUWCM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|