C19H31NO4 — CID 142090896
tert-butyl pyrrolidine-2-carboxylate;3-phenylmethoxypropan-1-ol (PubChem CID 142090896) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl pyrrolidine-2-carboxylate;3-phenylmethoxypropan-1-ol.
| Compound Name | tert-butyl pyrrolidine-2-carboxylate;3-phenylmethoxypropan-1-ol |
|---|---|
| PubChem CID | 142090896 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl pyrrolidine-2-carboxylate;3-phenylmethoxypropan-1-ol |
| SMILES | CC(C)(C)OC(=O)C1CCCN1.OCCCOCc1ccccc1 |
| InChI | InChI=1S/C10H14O2.C9H17NO2/c11-7-4-8-12-9-10-5-2-1-3-6-10;1-9(2,3)12-8(11)7-5-4-6-10-7/h1-3,5-6,11H,4,7-9H2;7,10H,4-6H2,1-3H3 |
| InChIKey | QSBPNZLVZKRQIK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|