C21H28N2O6S2 — CID 74764862
N-(benzenesulfonyl)benzenesulfonamide;tert-butyl pyrrolidine-2-carboxylate (PubChem CID 74764862) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-(benzenesulfonyl)benzenesulfonamide;tert-butyl pyrrolidine-2-carboxylate.
| Compound Name | N-(benzenesulfonyl)benzenesulfonamide;tert-butyl pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 74764862 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-(benzenesulfonyl)benzenesulfonamide;tert-butyl pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN1.O=S(=O)(NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11NO4S2.C9H17NO2/c14-18(15,11-7-3-1-4-8-11)13-19(16,17)12-9-5-2-6-10-12;1-9(2,3)12-8(11)7-5-4-6-10-7/h1-10,13H;7,10H,4-6H2,1-3H3 |
| InChIKey | QWCDJOBXFKHRJN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |