C19H23NOS — CID 169145096
2-[methyl(diphenyl)-λ4-sulfanyl]-1-pyrrolidin-2-ylethanone (PubChem CID 169145096) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-[methyl(diphenyl)-λ4-sulfanyl]-1-pyrrolidin-2-ylethanone.
| Compound Name | 2-[methyl(diphenyl)-λ4-sulfanyl]-1-pyrrolidin-2-ylethanone |
|---|---|
| PubChem CID | 169145096 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[methyl(diphenyl)-λ4-sulfanyl]-1-pyrrolidin-2-ylethanone |
| SMILES | CS(CC(=O)C1CCCN1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NOS/c1-22(16-9-4-2-5-10-16,17-11-6-3-7-12-17)15-19(21)18-13-8-14-20-18/h2-7,9-12,18,20H,8,13-15H2,1H3 |
| InChIKey | MZBJQORQNFFHMV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |