C12H17ClN2O — CID 146049803
(2S,5R)-N-methyl-5-phenylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 146049803) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is (2S,5R)-N-methyl-5-phenylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-N-methyl-5-phenylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146049803 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2S,5R)-N-methyl-5-phenylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CNC(=O)[C@@H]1CC[C@H](c2ccccc2)N1.Cl |
| InChI | InChI=1S/C12H16N2O.ClH/c1-13-12(15)11-8-7-10(14-11)9-5-3-2-4-6-9;/h2-6,10-11,14H,7-8H2,1H3,(H,13,15);1H/t10-,11+;/m1./s1 |
| InChIKey | CUWAXGPYYZOQSB-DHXVBOOMSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |