C19H23N3O3S — CID 154569424
(2R,5R)-5-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 154569424) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (2R,5R)-5-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,5R)-5-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154569424 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (2R,5R)-5-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)[C@H]2CC[C@H](c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c20-26(24,25)16-8-6-14(7-9-16)12-13-21-19(23)18-11-10-17(22-18)15-4-2-1-3-5-15/h1-9,17-18,22H,10-13H2,(H,21,23)(H2,20,24,25)/t17-,18-/m1/s1 |
| InChIKey | ZPCDDYJXFZWJGT-QZTJIDSGSA-N |
| XLogP | 1.49 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |