C16H24NO4P — CID 139254814
1-[(2S,3S,5S)-5-diethoxyphosphoryl-2-phenylpyrrolidin-3-yl]ethanone (PubChem CID 139254814) has the molecular formula C16H24NO4P and a molecular weight of 325.35 g/mol. Its IUPAC name is 1-[(2S,3S,5S)-5-diethoxyphosphoryl-2-phenylpyrrolidin-3-yl]ethanone.
| Compound Name | 1-[(2S,3S,5S)-5-diethoxyphosphoryl-2-phenylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 139254814 |
| Molecular Formula | C16H24NO4P |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[(2S,3S,5S)-5-diethoxyphosphoryl-2-phenylpyrrolidin-3-yl]ethanone |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@H](C(C)=O)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C16H24NO4P/c1-4-20-22(19,21-5-2)15-11-14(12(3)18)16(17-15)13-9-7-6-8-10-13/h6-10,14-17H,4-5,11H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | LPAQIIDZDDRFFA-OWCLPIDISA-N |
| XLogP | 3.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|