C19H28NO5P — CID 132560803
methyl (2S,3S,5R)-5-diethoxyphosphoryl-2-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate (PubChem CID 132560803) has the molecular formula C19H28NO5P and a molecular weight of 381.41 g/mol. Its IUPAC name is methyl (2S,3S,5R)-5-diethoxyphosphoryl-2-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3S,5R)-5-diethoxyphosphoryl-2-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 132560803 |
| Molecular Formula | C19H28NO5P |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl (2S,3S,5R)-5-diethoxyphosphoryl-2-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@H](C(=O)OC)[C@H](C/C=C/c2ccccc2)N1 |
| InChI | InChI=1S/C19H28NO5P/c1-4-24-26(22,25-5-2)18-14-16(19(21)23-3)17(20-18)13-9-12-15-10-7-6-8-11-15/h6-12,16-18,20H,4-5,13-14H2,1-3H3/b12-9+/t16-,17-,18+/m0/s1 |
| InChIKey | VWGBTVBMTVHDHT-YCSGXKPUSA-N |
| XLogP | 3.83 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|