C17H27N2O4P — CID 132560805
(2R,3S,5R)-5-diethoxyphosphoryl-N,N-dimethyl-2-phenylpyrrolidine-3-carboxamide (PubChem CID 132560805) has the molecular formula C17H27N2O4P and a molecular weight of 354.39 g/mol. Its IUPAC name is (2R,3S,5R)-5-diethoxyphosphoryl-N,N-dimethyl-2-phenylpyrrolidine-3-carboxamide.
| Compound Name | (2R,3S,5R)-5-diethoxyphosphoryl-N,N-dimethyl-2-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 132560805 |
| Molecular Formula | C17H27N2O4P |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2R,3S,5R)-5-diethoxyphosphoryl-N,N-dimethyl-2-phenylpyrrolidine-3-carboxamide |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@H](C(=O)N(C)C)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C17H27N2O4P/c1-5-22-24(21,23-6-2)15-12-14(17(20)19(3)4)16(18-15)13-10-8-7-9-11-13/h7-11,14-16,18H,5-6,12H2,1-4H3/t14-,15+,16-/m0/s1 |
| InChIKey | GAEPOIFFUVTTQN-XHSDSOJGSA-N |
| XLogP | 3.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|