C15H24NO3P — CID 11335470
(2R,6R)-2-diethoxyphosphoryl-6-phenylpiperidine (PubChem CID 11335470) has the molecular formula C15H24NO3P and a molecular weight of 297.33 g/mol. Its IUPAC name is (2R,6R)-2-diethoxyphosphoryl-6-phenylpiperidine.
| Compound Name | (2R,6R)-2-diethoxyphosphoryl-6-phenylpiperidine |
|---|---|
| PubChem CID | 11335470 |
| Molecular Formula | C15H24NO3P |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (2R,6R)-2-diethoxyphosphoryl-6-phenylpiperidine |
| SMILES | CCOP(=O)(OCC)[C@@H]1CCC[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C15H24NO3P/c1-3-18-20(17,19-4-2)15-12-8-11-14(16-15)13-9-6-5-7-10-13/h5-7,9-10,14-16H,3-4,8,11-12H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | CLRYYBASLKUMEY-HUUCEWRRSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|