C10H22NO3P — CID 11402086
(2R,6S)-2-diethoxyphosphoryl-6-methylpiperidine (PubChem CID 11402086) has the molecular formula C10H22NO3P and a molecular weight of 235.26 g/mol. Its IUPAC name is (2R,6S)-2-diethoxyphosphoryl-6-methylpiperidine.
| Compound Name | (2R,6S)-2-diethoxyphosphoryl-6-methylpiperidine |
|---|---|
| PubChem CID | 11402086 |
| Molecular Formula | C10H22NO3P |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (2R,6S)-2-diethoxyphosphoryl-6-methylpiperidine |
| SMILES | CCOP(=O)(OCC)[C@@H]1CCC[C@H](C)N1 |
| InChI | InChI=1S/C10H22NO3P/c1-4-13-15(12,14-5-2)10-8-6-7-9(3)11-10/h9-11H,4-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | IUIAHWQJKLSWQG-VHSXEESVSA-N |
| XLogP | 2.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|