C11H24NO4P — CID 10491916
4-diethoxyphosphoryl-2,5,5-trimethyl-1,3-oxazinane (PubChem CID 10491916) has the molecular formula C11H24NO4P and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-2,5,5-trimethyl-1,3-oxazinane.
| Compound Name | 4-diethoxyphosphoryl-2,5,5-trimethyl-1,3-oxazinane |
|---|---|
| PubChem CID | 10491916 |
| Molecular Formula | C11H24NO4P |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-diethoxyphosphoryl-2,5,5-trimethyl-1,3-oxazinane |
| SMILES | CCOP(=O)(OCC)C1NC(C)OCC1(C)C |
| InChI | InChI=1S/C11H24NO4P/c1-6-15-17(13,16-7-2)10-11(4,5)8-14-9(3)12-10/h9-10,12H,6-8H2,1-5H3 |
| InChIKey | MDDUHFLMQHUXPJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|