C9H19O4P — CID 24975893
2-diethoxyphosphoryl-2,3,3-trimethyloxirane (PubChem CID 24975893) has the molecular formula C9H19O4P and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2,3,3-trimethyloxirane.
| Compound Name | 2-diethoxyphosphoryl-2,3,3-trimethyloxirane |
|---|---|
| PubChem CID | 24975893 |
| Molecular Formula | C9H19O4P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-diethoxyphosphoryl-2,3,3-trimethyloxirane |
| SMILES | CCOP(=O)(OCC)C1(C)OC1(C)C |
| InChI | InChI=1S/C9H19O4P/c1-6-11-14(10,12-7-2)9(5)8(3,4)13-9/h6-7H2,1-5H3 |
| InChIKey | XBWWRMUQXBRSIG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|