About 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole
2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole (PubChem CID 15882675) has the molecular formula C9H18NO3P
and a molecular weight of 219.22 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole.
Molecular Properties
| Compound Name | 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole |
| PubChem CID | 15882675 |
| Molecular Formula | C9H18NO3P |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole |
| SMILES | CCOP(=O)(OCC)C1(C)CCC=N1 |
| InChI | InChI=1S/C9H18NO3P/c1-4-12-14(11,13-5-2)9(3)7-6-8-10-9/h8H,4-7H2,1-3H3 |
| InChIKey | BARQDOIFWWXBNM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole?
The IUPAC name of 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole (CID 15882675) is 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole.
What is the SMILES notation for 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole?
The canonical SMILES for 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole is CCOP(=O)(OCC)C1(C)CCC=N1.
What is the InChIKey of 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole?
The InChIKey is BARQDOIFWWXBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO3P/c1-4-12-14(11,13-5-2)9(3)7-6-8-10-9/h8H,4-7H2,1-3H3.
What are the key properties of 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole?
2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole has a molecular weight of 219.22 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphoryl-2-methyl-3,4-dihydropyrrole is sourced from PubChem (CID 15882675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).