C10H21N2O2P — CID 26990
1-[(2,2-dimethylaziridin-1-yl)-ethoxyphosphoryl]-2,2-dimethylaziridine (PubChem CID 26990) has the molecular formula C10H21N2O2P and a molecular weight of 232.26 g/mol. Its IUPAC name is 1-[(2,2-dimethylaziridin-1-yl)-ethoxyphosphoryl]-2,2-dimethylaziridine.
| Compound Name | 1-[(2,2-dimethylaziridin-1-yl)-ethoxyphosphoryl]-2,2-dimethylaziridine |
|---|---|
| PubChem CID | 26990 |
| Molecular Formula | C10H21N2O2P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-[(2,2-dimethylaziridin-1-yl)-ethoxyphosphoryl]-2,2-dimethylaziridine |
| SMILES | CCOP(=O)(N1CC1(C)C)N1CC1(C)C |
| InChI | InChI=1S/C10H21N2O2P/c1-6-14-15(13,11-7-9(11,2)3)12-8-10(12,4)5/h6-8H2,1-5H3 |
| InChIKey | SOYAWOSQURUWHG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|