C10H20NO3P — CID 11424790
(2R)-2-diethoxyphosphoryl-2,5-dimethyl-3,4-dihydropyrrole (PubChem CID 11424790) has the molecular formula C10H20NO3P and a molecular weight of 233.25 g/mol. Its IUPAC name is (2R)-2-diethoxyphosphoryl-2,5-dimethyl-3,4-dihydropyrrole.
| Compound Name | (2R)-2-diethoxyphosphoryl-2,5-dimethyl-3,4-dihydropyrrole |
|---|---|
| PubChem CID | 11424790 |
| Molecular Formula | C10H20NO3P |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2R)-2-diethoxyphosphoryl-2,5-dimethyl-3,4-dihydropyrrole |
| SMILES | CCOP(=O)(OCC)[C@]1(C)CCC(C)=N1 |
| InChI | InChI=1S/C10H20NO3P/c1-5-13-15(12,14-6-2)10(4)8-7-9(3)11-10/h5-8H2,1-4H3/t10-/m1/s1 |
| InChIKey | QYKOOOYOQWRAQO-SNVBAGLBSA-N |
| XLogP | 3.22 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|