C13H20NO3P — CID 102390457
(1S)-1-diethoxyphosphoryl-2,3-dihydroinden-1-amine (PubChem CID 102390457) has the molecular formula C13H20NO3P and a molecular weight of 269.28 g/mol. Its IUPAC name is (1S)-1-diethoxyphosphoryl-2,3-dihydroinden-1-amine.
| Compound Name | (1S)-1-diethoxyphosphoryl-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 102390457 |
| Molecular Formula | C13H20NO3P |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (1S)-1-diethoxyphosphoryl-2,3-dihydroinden-1-amine |
| SMILES | CCOP(=O)(OCC)[C@@]1(N)CCc2ccccc21 |
| InChI | InChI=1S/C13H20NO3P/c1-3-16-18(15,17-4-2)13(14)10-9-11-7-5-6-8-12(11)13/h5-8H,3-4,9-10,14H2,1-2H3/t13-/m0/s1 |
| InChIKey | XXFYXZHSMPDWAQ-ZDUSSCGKSA-N |
| XLogP | 3.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|