C19H30NO5P — CID 102390460
tert-butyl N-[(1R)-1-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-yl]carbamate (PubChem CID 102390460) has the molecular formula C19H30NO5P and a molecular weight of 383.43 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 102390460 |
| Molecular Formula | C19H30NO5P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | tert-butyl N-[(1R)-1-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-yl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@]1(NC(=O)OC(C)(C)C)CCCc2ccccc21 |
| InChI | InChI=1S/C19H30NO5P/c1-6-23-26(22,24-7-2)19(20-17(21)25-18(3,4)5)14-10-12-15-11-8-9-13-16(15)19/h8-9,11,13H,6-7,10,12,14H2,1-5H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | UJCCLCRPWHLLRO-LJQANCHMSA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|