C15H28NO7P — CID 135025425
tert-butyl N-[(1R)-1-diethoxyphosphoryl-2-oxocyclohexyl]oxycarbamate (PubChem CID 135025425) has the molecular formula C15H28NO7P and a molecular weight of 365.36 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-diethoxyphosphoryl-2-oxocyclohexyl]oxycarbamate.
| Compound Name | tert-butyl N-[(1R)-1-diethoxyphosphoryl-2-oxocyclohexyl]oxycarbamate |
|---|---|
| PubChem CID | 135025425 |
| Molecular Formula | C15H28NO7P |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | tert-butyl N-[(1R)-1-diethoxyphosphoryl-2-oxocyclohexyl]oxycarbamate |
| SMILES | CCOP(=O)(OCC)[C@]1(ONC(=O)OC(C)(C)C)CCCCC1=O |
| InChI | InChI=1S/C15H28NO7P/c1-6-20-24(19,21-7-2)15(11-9-8-10-12(15)17)23-16-13(18)22-14(3,4)5/h6-11H2,1-5H3,(H,16,18)/t15-/m1/s1 |
| InChIKey | UCXIEJFAVBYPBG-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|