C14H24O6P- — CID 23422027
2-diethoxyphosphoryl-3-[(1S)-1-methyl-2-oxocyclohexyl]propanoate (PubChem CID 23422027) has the molecular formula C14H24O6P- and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3-[(1S)-1-methyl-2-oxocyclohexyl]propanoate.
| Compound Name | 2-diethoxyphosphoryl-3-[(1S)-1-methyl-2-oxocyclohexyl]propanoate |
|---|---|
| PubChem CID | 23422027 |
| Molecular Formula | C14H24O6P- |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-diethoxyphosphoryl-3-[(1S)-1-methyl-2-oxocyclohexyl]propanoate |
| SMILES | CCOP(=O)(OCC)C(C[C@]1(C)CCCCC1=O)C(=O)[O-] |
| InChI | InChI=1S/C14H25O6P/c1-4-19-21(18,20-5-2)11(13(16)17)10-14(3)9-7-6-8-12(14)15/h11H,4-10H2,1-3H3,(H,16,17)/p-1/t11?,14-/m0/s1 |
| InChIKey | ZWYPJDWVZXYLRA-IAXJKZSUSA-M |
| XLogP | 1.91 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|