C17H29O6P — CID 101458042
2-diethoxyphosphoryl-3-[(1S,4R)-1-methyl-2-oxo-4-prop-1-en-2-ylcyclohexyl]propanoic acid (PubChem CID 101458042) has the molecular formula C17H29O6P and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3-[(1S,4R)-1-methyl-2-oxo-4-prop-1-en-2-ylcyclohexyl]propanoic acid.
| Compound Name | 2-diethoxyphosphoryl-3-[(1S,4R)-1-methyl-2-oxo-4-prop-1-en-2-ylcyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 101458042 |
| Molecular Formula | C17H29O6P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-diethoxyphosphoryl-3-[(1S,4R)-1-methyl-2-oxo-4-prop-1-en-2-ylcyclohexyl]propanoic acid |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(CC(C(=O)O)P(=O)(OCC)OCC)C(=O)C1 |
| InChI | InChI=1S/C17H29O6P/c1-6-22-24(21,23-7-2)14(16(19)20)11-17(5)9-8-13(12(3)4)10-15(17)18/h13-14H,3,6-11H2,1-2,4-5H3,(H,19,20)/t13-,14?,17+/m1/s1 |
| InChIKey | DDUOLODEYDXJKD-HFIQTRLSSA-N |
| XLogP | 4.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|