C16H26O4 — CID 91573229
(1-acetyloxy-2-ethyl-2-methyl-5-prop-1-en-2-ylcyclohexyl) acetate (PubChem CID 91573229) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1-acetyloxy-2-ethyl-2-methyl-5-prop-1-en-2-ylcyclohexyl) acetate.
| Compound Name | (1-acetyloxy-2-ethyl-2-methyl-5-prop-1-en-2-ylcyclohexyl) acetate |
|---|---|
| PubChem CID | 91573229 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1-acetyloxy-2-ethyl-2-methyl-5-prop-1-en-2-ylcyclohexyl) acetate |
| SMILES | C=C(C)C1CCC(C)(CC)C(OC(C)=O)(OC(C)=O)C1 |
| InChI | InChI=1S/C16H26O4/c1-7-15(6)9-8-14(11(2)3)10-16(15,19-12(4)17)20-13(5)18/h14H,2,7-10H2,1,3-6H3 |
| InChIKey | MYCXKPAQUWPCIN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|