C18H24O5 — CID 101375347
2-O-[(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] 1-O-methyl oxalate (PubChem CID 101375347) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-O-[(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] 1-O-methyl oxalate.
| Compound Name | 2-O-[(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 101375347 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-O-[(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] 1-O-methyl oxalate |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(OC(=O)C(=O)OC)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C18H24O5/c1-10(2)12-6-7-18(4,23-17(21)16(20)22-5)14-9-15(19)11(3)13(14)8-12/h12,14H,1,6-9H2,2-5H3/t12-,14-,18-/m1/s1 |
| InChIKey | WUEBTZLKVLQZSC-RVZJWNSFSA-N |
| XLogP | 2.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|