About methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate
methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate (PubChem CID 163055633) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate |
| PubChem CID | 163055633 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1CCC2(C1)C(C)=CC(=O)CC2C |
| InChI | InChI=1S/C16H22O3/c1-10-7-14(17)8-11(2)16(10)6-5-13(9-16)12(3)15(18)19-4/h7,11,13H,3,5-6,8-9H2,1-2,4H3 |
| InChIKey | SSNRBHZIHVCWJI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate?
The IUPAC name of methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate (CID 163055633) is methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate.
What is the SMILES notation for methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate?
The canonical SMILES for methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate is C=C(C(=O)OC)C1CCC2(C1)C(C)=CC(=O)CC2C.
What is the InChIKey of methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate?
The InChIKey is SSNRBHZIHVCWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-10-7-14(17)8-11(2)16(10)6-5-13(9-16)12(3)15(18)19-4/h7,11,13H,3,5-6,8-9H2,1-2,4H3.
What are the key properties of methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate?
methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate has a molecular weight of 262.35 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6,10-dimethyl-8-oxospiro[4.5]dec-9-en-3-yl)prop-2-enoate is sourced from PubChem (CID 163055633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).