C16H20O4 — CID 162940931
methyl 2-[(3aS,5R)-3a-hydroxy-3,8-dimethyl-1-oxo-4,5,6,7-tetrahydroazulen-5-yl]prop-2-enoate (PubChem CID 162940931) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl 2-[(3aS,5R)-3a-hydroxy-3,8-dimethyl-1-oxo-4,5,6,7-tetrahydroazulen-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(3aS,5R)-3a-hydroxy-3,8-dimethyl-1-oxo-4,5,6,7-tetrahydroazulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162940931 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl 2-[(3aS,5R)-3a-hydroxy-3,8-dimethyl-1-oxo-4,5,6,7-tetrahydroazulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CCC(C)=C2C(=O)C=C(C)[C@@]2(O)C1 |
| InChI | InChI=1S/C16H20O4/c1-9-5-6-12(11(3)15(18)20-4)8-16(19)10(2)7-13(17)14(9)16/h7,12,19H,3,5-6,8H2,1-2,4H3/t12-,16+/m1/s1 |
| InChIKey | LYUNLVGDPZGFCA-WBMJQRKESA-N |
| XLogP | 2.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|