C20H24O5 — CID 74051741
6-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-15,17-dioxatetracyclo[11.2.2.01,14.06,10]heptadeca-7,10-diene-9,16-dione (PubChem CID 74051741) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 6-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-15,17-dioxatetracyclo[11.2.2.01,14.06,10]heptadeca-7,10-diene-9,16-dione.
| Compound Name | 6-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-15,17-dioxatetracyclo[11.2.2.01,14.06,10]heptadeca-7,10-diene-9,16-dione |
|---|---|
| PubChem CID | 74051741 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 6-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-15,17-dioxatetracyclo[11.2.2.01,14.06,10]heptadeca-7,10-diene-9,16-dione |
| SMILES | C=C(C)C1CCC23OC2C(CC(C)=C2C(=O)C=C(C)C2(O)C1)OC3=O |
| InChI | InChI=1S/C20H24O5/c1-10(2)13-5-6-20-17(25-20)15(24-18(20)22)7-11(3)16-14(21)8-12(4)19(16,23)9-13/h8,13,15,17,23H,1,5-7,9H2,2-4H3 |
| InChIKey | SCLQLWOMIGFXSK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|