C23H28O8 — CID 162988251
methyl (2E,5R,8S,11S,17R)-17-acetyloxy-8-hydroxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-triene-14-carboxylate (PubChem CID 162988251) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is methyl (2E,5R,8S,11S,17R)-17-acetyloxy-8-hydroxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-triene-14-carboxylate.
| Compound Name | methyl (2E,5R,8S,11S,17R)-17-acetyloxy-8-hydroxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-triene-14-carboxylate |
|---|---|
| PubChem CID | 162988251 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl (2E,5R,8S,11S,17R)-17-acetyloxy-8-hydroxy-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-triene-14-carboxylate |
| SMILES | C=C(C)[C@H]1CC[C@@]2(O)C(=O)O[C@H](C/C(C)=C/c3cc(C(=O)OC)c(o3)C1)[C@H]2OC(C)=O |
| InChI | InChI=1S/C23H28O8/c1-12(2)15-6-7-23(27)20(29-14(4)24)19(31-22(23)26)9-13(3)8-16-11-17(21(25)28-5)18(10-15)30-16/h8,11,15,19-20,27H,1,6-7,9-10H2,2-5H3/b13-8+/t15-,19+,20+,23-/m0/s1 |
| InChIKey | QLIZJLIWTZJOJS-GJHKSGSZSA-N |
| XLogP | 2.98 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|