C26H38O5Si — CID 135798314
(2E,5R,11R)-14-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-3-methyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one (PubChem CID 135798314) has the molecular formula C26H38O5Si and a molecular weight of 458.67 g/mol. Its IUPAC name is (2E,5R,11R)-14-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-3-methyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one.
| Compound Name | (2E,5R,11R)-14-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-3-methyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one |
|---|---|
| PubChem CID | 135798314 |
| Molecular Formula | C26H38O5Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (2E,5R,11R)-14-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-3-methyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one |
| SMILES | C=C(C)[C@H]1Cc2oc(cc2CO[Si](C)(C)C(C)(C)C)/C=C(\C)C[C@@H]2C=C(C(=O)O2)C(O)C1 |
| InChI | InChI=1S/C26H38O5Si/c1-16(2)18-12-23(27)22-14-21(31-25(22)28)10-17(3)9-20-11-19(24(13-18)30-20)15-29-32(7,8)26(4,5)6/h9,11,14,18,21,23,27H,1,10,12-13,15H2,2-8H3/b17-9+/t18-,21-,23?/m1/s1 |
| InChIKey | FNSDAEYMVSVDAJ-XFMIWDMXSA-N |
| XLogP | 5.95 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|