C22H35BrO4Si2 — CID 90395474
6-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]chromen-2-one (PubChem CID 90395474) has the molecular formula C22H35BrO4Si2 and a molecular weight of 499.59 g/mol. Its IUPAC name is 6-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]chromen-2-one.
| Compound Name | 6-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]chromen-2-one |
|---|---|
| PubChem CID | 90395474 |
| Molecular Formula | C22H35BrO4Si2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 6-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]chromen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(=O)oc2cc(O[Si](C)(C)C(C)(C)C)c(Br)cc12 |
| InChI | InChI=1S/C22H35BrO4Si2/c1-21(2,3)28(7,8)25-14-15-11-20(24)26-18-13-19(17(23)12-16(15)18)27-29(9,10)22(4,5)6/h11-13H,14H2,1-10H3 |
| InChIKey | OVMWSHMOIVGNOF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|