C17H11Br3O3 — CID 25194311
6-methyl-4-[(2,4,6-tribromophenoxy)methyl]chromen-2-one (PubChem CID 25194311) has the molecular formula C17H11Br3O3 and a molecular weight of 502.98 g/mol. Its IUPAC name is 6-methyl-4-[(2,4,6-tribromophenoxy)methyl]chromen-2-one.
| Compound Name | 6-methyl-4-[(2,4,6-tribromophenoxy)methyl]chromen-2-one |
|---|---|
| PubChem CID | 25194311 |
| Molecular Formula | C17H11Br3O3 |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 499.83 |
| IUPAC Name | 6-methyl-4-[(2,4,6-tribromophenoxy)methyl]chromen-2-one |
| SMILES | Cc1ccc2oc(=O)cc(COc3c(Br)cc(Br)cc3Br)c2c1 |
| InChI | InChI=1S/C17H11Br3O3/c1-9-2-3-15-12(4-9)10(5-16(21)23-15)8-22-17-13(19)6-11(18)7-14(17)20/h2-7H,8H2,1H3 |
| InChIKey | OBOXNZRBROTUHR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|